CAS 1060810-17-4

5-Bromo-2-methyl-4-pyridinemethanamine

Description:

5-Bromo-2-methyl-4-pyridinemethanamine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 2-position of the pyridine ring contributes to its unique chemical properties. This compound features an amine functional group, which is indicative of its potential reactivity, particularly in nucleophilic substitution reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound's bromine substituent can enhance its reactivity, making it useful in various synthetic applications, including medicinal chemistry and the development of pharmaceuticals. Additionally, the specific arrangement of substituents on the pyridine ring can influence its biological activity, making it a subject of interest in drug discovery and development. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₉BrN₂

InChI: InChI=1S/C7H9BrN2/c1-5-2-6(3-9)7(8)4-10-5/h2,4H,3,9H2,1H3

InChI key: InChIKey=GFLDHMGZRLPQES-UHFFFAOYSA-N

SMILES: C(N)C=1C(Br)=CN=C(C)C1

Synonyms:

• 4-Pyridinemethanamine, 5-bromo-2-methyl-
• 5-Bromo-2-methyl-4-pyridinemethanamine