
CAS 1060810-25-4
:2-Chloro-6-(trifluoromethyl)-4-pyridinemethanamine
Description:
2-Chloro-6-(trifluoromethyl)-4-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 2-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research. The trifluoromethyl group enhances lipophilicity, potentially affecting its interaction with biological targets. Additionally, the amine functional group can participate in hydrogen bonding, influencing its solubility and reactivity. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 2-Chloro-6-(trifluoromethyl)-4-pyridinemethanamine is a versatile compound with applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C7H6ClF3N2
InChI:InChI=1S/C7H6ClF3N2/c8-6-2-4(3-12)1-5(13-6)7(9,10)11/h1-2H,3,12H2
InChI key:InChIKey=RPUXBIDOELRMCG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CN)=CC(Cl)=N1
Synonyms:- [2-Chloro-6-(trifluoromethyl)pyridin-4-yl]methanamine
- 4-Pyridinemethanamine, 2-chloro-6-(trifluoromethyl)-
- 2-Chloro-6-(trifluoromethyl)-4-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.