CAS 1060810-27-6

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxaldehyde

Description:

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 3-position and a trifluoromethyl group at the 6-position significantly influences its chemical reactivity and physical properties. This compound features an aldehyde functional group, which is known for its reactivity in various organic reactions, including nucleophilic addition and condensation reactions. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially affecting its biological activity. The compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its specific characteristics, such as boiling point, melting point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₃ClF₃NO

InChI: InChI=1S/C7H3ClF3NO/c8-4-1-2-6(7(9,10)11)12-5(4)3-13/h1-3H

InChI key: InChIKey=SARHUZHQSTUDAM-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(C=O)C(Cl)=CC1

Synonyms:

• 3-Chloro-6-(trifluoromethyl)picolinaldehyde
• 3-Chloro-6-(trifluoromethyl)pyridine-2-carbaldehyde
• 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 3-chloro-6-(trifluoromethyl)-