
CAS 1060810-39-0
:4-Chloro-6-methoxy-2-pyridinemethanamine
Description:
4-Chloro-6-methoxy-2-pyridinemethanamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of a chloro group at the 4-position and a methoxy group at the 6-position of the pyridine ring contributes to its unique chemical properties. This compound features an amine functional group, which enhances its reactivity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and methoxy groups. The compound's structure suggests potential biological activity, which may be explored in medicinal chemistry. Additionally, its specific interactions with biological targets could be of interest in drug development. As with many chemical substances, safety data should be consulted to understand its handling and toxicity.
Formula:C7H9ClN2O
InChI:InChI=1S/C7H9ClN2O/c1-11-7-3-5(8)2-6(4-9)10-7/h2-3H,4,9H2,1H3
InChI key:InChIKey=FXKFVJSXQYZUIK-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(OC)C=C(Cl)C1
Synonyms:- 2-Pyridinemethanamine, 4-chloro-6-methoxy-
- 4-Chloro-6-methoxy-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
