CymitQuimica logo

CAS 1060810-46-9

:

4-Bromo-6-methoxy-2-pyridinecarboxylic acid

Description:
4-Bromo-6-methoxy-2-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group, which imparts acidic characteristics and enhances its solubility in polar solvents. The bromine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group can also affect the electronic properties of the molecule, potentially enhancing its reactivity or stability. Due to its structural features, 4-Bromo-6-methoxy-2-pyridinecarboxylic acid may find applications in medicinal chemistry, agrochemicals, or as an intermediate in organic synthesis. Its specific interactions and behavior in biological systems or chemical reactions would depend on the surrounding conditions and the presence of other functional groups.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-6-3-4(8)2-5(9-6)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=ADVSZVFLCMWHGR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(OC)C=C(Br)C1
Synonyms:
  • 4-Bromo-6-methoxy-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 4-bromo-6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.