CAS 1060810-63-0

4-Bromo-6-(trifluoromethyl)-3-pyridinecarboxaldehyde

Description:

4-Bromo-6-(trifluoromethyl)-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. The aldehyde functional group at the 3-position contributes to its ability to undergo various chemical reactions, such as nucleophilic addition and condensation. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its unique electronic and steric properties. Its trifluoromethyl group enhances lipophilicity and metabolic stability, making it a valuable building block in drug design. Additionally, the compound's structure suggests potential applications in materials science and as a reagent in various chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₃BrF₃NO

InChI: InChI=1S/C7H3BrF3NO/c8-5-1-6(7(9,10)11)12-2-4(5)3-13/h1-3H

InChI key: InChIKey=QVZVEWCPNLENSL-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(Br)=C(C=O)C=N1

Synonyms:

• 4-Bromo-6-(trifluoromethyl)-3-pyridinecarboxaldehyde
• 3-Pyridinecarboxaldehyde, 4-bromo-6-(trifluoromethyl)-

4-Bromo-6-(trifluoromethyl)nicotinaldehyde

CAS: 1060810-63-0

Formula: C₇H₃BrF₃NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 254.0040

Ref: IN-DA00957Y