CAS 1060810-76-5

Methyl 4-hydroxy-6-(trifluoromethyl)-2-pyridinecarboxylate

Description:

Methyl 4-hydroxy-6-(trifluoromethyl)-2-pyridinecarboxylate, identified by its CAS number 1060810-76-5, is a chemical compound that belongs to the class of pyridinecarboxylates. This substance features a pyridine ring substituted with a hydroxyl group and a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. The methyl ester functional group contributes to its solubility in organic solvents and can participate in various chemical reactions, such as hydrolysis or transesterification. This compound may exhibit interesting pharmacological properties, potentially serving as a lead compound in drug development. Its synthesis and characterization typically involve standard organic chemistry techniques, and it may be utilized in research related to agrochemicals or pharmaceuticals. As with many fluorinated compounds, it is essential to handle it with care due to potential environmental and health impacts.

Formula: C₈H₆F₃NO₃

InChI: InChI=1S/C8H6F3NO3/c1-15-7(14)5-2-4(13)3-6(12-5)8(9,10)11/h2-3H,1H3,(H,12,13)

InChI key: InChIKey=LCOBQFIHSUVKPE-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C(C(F)(F)F)C=C(O)C1

Synonyms:

• 2-Pyridinecarboxylic acid, 4-hydroxy-6-(trifluoromethyl)-, methyl ester
• Methyl 4-hydroxy-6-(trifluoromethyl)-2-pyridinecarboxylate