
CAS 1060810-97-0
:1-[6-(Trifluoromethyl)-3-pyridinyl]cyclopropanamine
Description:
1-[6-(Trifluoromethyl)-3-pyridinyl]cyclopropanamine is a chemical compound characterized by its unique structural features, which include a cyclopropanamine moiety and a trifluoromethyl-substituted pyridine ring. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the pyridine ring contributes to the compound's potential as a ligand in various chemical interactions, particularly in biological systems. This compound may exhibit properties such as being a potential inhibitor or modulator in pharmacological applications, although specific biological activities would depend on further empirical studies. Additionally, the trifluoromethyl group can affect the compound's stability and reactivity, making it a subject of interest in synthetic organic chemistry. Overall, 1-[6-(Trifluoromethyl)-3-pyridinyl]cyclopropanamine represents a class of compounds that may have significant implications in drug discovery and development, particularly in targeting specific biological pathways.
Formula:C9H9F3N2
InChI:InChI=1S/C9H9F3N2/c10-9(11,12)7-2-1-6(5-14-7)8(13)3-4-8/h1-2,5H,3-4,13H2
InChI key:InChIKey=LDNFXTSHKMVBTK-UHFFFAOYSA-N
SMILES:NC1(CC1)C=2C=CC(C(F)(F)F)=NC2
Synonyms:- 1-[6-(Trifluoromethyl)-3-pyridinyl]cyclopropanamine
- Cyclopropanamine, 1-[6-(trifluoromethyl)-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.