CAS 1060811-12-2

6-(Trifluoromethyl)-2-pyridinepropanamine

Description:

6-(Trifluoromethyl)-2-pyridinepropanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound is likely to exhibit polar characteristics due to the nitrogen atom in the amine group, which can participate in hydrogen bonding. The pyridine moiety contributes to its aromaticity and stability, while also providing potential sites for further chemical modifications. Given its structure, this compound may be of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its specific interactions with biological targets would depend on its conformation and the electronic effects imparted by the trifluoromethyl group. As with many fluorinated compounds, it may exhibit unique reactivity patterns and solubility characteristics, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₉H₁₁F₃N₂

InChI: InChI=1S/C9H11F3N2/c10-9(11,12)8-5-1-3-7(14-8)4-2-6-13/h1,3,5H,2,4,6,13H2

InChI key: InChIKey=WFSVLEBMKMQQNC-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(CCCN)C=CC1

Synonyms:

• 6-(Trifluoromethyl)-2-pyridinepropanamine
• 2-Pyridinepropanamine, 6-(trifluoromethyl)-