CymitQuimica logo

CAS 1060811-31-5

:

2-Bromo-N-methyl-4-pyridinemethanamine

Description:
2-Bromo-N-methyl-4-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the second position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The N-methyl group indicates that there is a methyl substituent on the nitrogen atom, which can influence the compound's basicity and steric properties. This compound is likely to exhibit polar characteristics due to the presence of both the amine and bromine functional groups, making it soluble in polar solvents. Its structure suggests potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyridine ring is a common motif in many biologically active compounds. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the bromine atom. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-9-5-6-2-3-10-7(8)4-6/h2-4,9H,5H2,1H3
InChI key:InChIKey=KMQWTXXQXBHNJU-UHFFFAOYSA-N
SMILES:C(NC)C=1C=C(Br)N=CC1
Synonyms:
  • 4-Pyridinemethanamine, 2-bromo-N-methyl-
  • 2-Bromo-N-methyl-4-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.