
CAS 1060811-48-4
:1-(6-Bromo-2-pyridinyl)cyclopropanemethanamine
Description:
1-(6-Bromo-2-pyridinyl)cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a bromine atom. The presence of the bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is classified as an amine due to the presence of the amine functional group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The cyclopropane structure introduces ring strain, which can influence the compound's stability and reactivity. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its synthesis, characterization, and biological evaluation. Overall, 1-(6-Bromo-2-pyridinyl)cyclopropanemethanamine represents a versatile scaffold for potential drug development and chemical research.
Formula:C9H11BrN2
InChI:InChI=1S/C9H11BrN2/c10-8-3-1-2-7(12-8)9(6-11)4-5-9/h1-3H,4-6,11H2
InChI key:InChIKey=JDNWHVHTUQZMRG-UHFFFAOYSA-N
SMILES:C(N)C1(CC1)C=2N=C(Br)C=CC2
Synonyms:- 1-(6-Bromo-2-pyridinyl)cyclopropanemethanamine
- Cyclopropanemethanamine, 1-(6-bromo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.