CAS 1060811-50-8

1-(6-Bromo-3-pyridinyl)cyclopropanemethanamine

Description:

1-(6-Bromo-3-pyridinyl)cyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a bromine atom. The presence of the bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is classified as an amine due to the presence of the amine functional group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The cyclopropane structure adds strain and rigidity to the molecule, influencing its conformational properties and interactions with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including its interaction with biological systems and potential therapeutic uses. As with many chemical substances, safety and handling precautions are essential due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₉H₁₁BrN₂

InChI: InChI=1S/C9H11BrN2/c10-8-2-1-7(5-12-8)9(6-11)3-4-9/h1-2,5H,3-4,6,11H2

InChI key: InChIKey=DIKZNHHXEVXHOD-UHFFFAOYSA-N

SMILES: C(N)C1(CC1)C=2C=CC(Br)=NC2

Synonyms:

• [1-(6-Bromopyridin-3-yl)cyclopropyl]methanamine
• Cyclopropanemethanamine, 1-(6-bromo-3-pyridinyl)-
• 1-(6-Bromo-3-pyridinyl)cyclopropanemethanamine