CAS 1060811-56-4
:6-Bromo-α-methyl-3-pyridinemethanamine
Description:
6-Bromo-α-methyl-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The α-methyl group indicates that there is a methyl substituent on the carbon adjacent to the nitrogen atom in the side chain, which can influence the compound's steric and electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its amine functional group suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. Additionally, the specific arrangement of substituents can lead to unique pharmacological properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous. Overall, 6-Bromo-α-methyl-3-pyridinemethanamine represents a versatile structure for further exploration in chemical research.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-5(9)6-2-3-7(8)10-4-6/h2-5H,9H2,1H3
InChI key:InChIKey=COGGCXWSBTVYEV-UHFFFAOYSA-N
SMILES:C(C)(N)C=1C=CC(Br)=NC1
Synonyms:- 3-Pyridinemethanamine, 6-bromo-α-methyl-
- 1-(6-Bromo-pyridin-3-yl)-ethylamine
- 1-(6-Bromopyridin-3-yl)ethan-1-amine
- 6-Bromo-α-methyl-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.