CAS 1060811-73-5

1-(2-Chloro-4-pyridinyl)cyclopropanamine

Description:

1-(2-Chloro-4-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a chlorine atom. This compound typically exhibits properties associated with both amines and heterocyclic compounds. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The presence of the chlorine atom can influence its reactivity and solubility, while the cyclopropane ring may impart strain, affecting its stability and reactivity. Additionally, the pyridine ring can contribute to the compound's basicity and potential for forming coordination complexes. As with many organic compounds, its behavior in various solvents and under different conditions can vary significantly, making it important to consider its specific context in research or application. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₉ClN₂

InChI: InChI=1S/C8H9ClN2/c9-7-5-6(1-4-11-7)8(10)2-3-8/h1,4-5H,2-3,10H2

InChI key: InChIKey=OHMWFACDYCRXQH-UHFFFAOYSA-N

SMILES: NC1(CC1)C=2C=C(Cl)N=CC2

Synonyms:

• 1-(2-Chloro-4-pyridinyl)cyclopropanamine
• Cyclopropanamine, 1-(2-chloro-4-pyridinyl)-