
CAS 1060811-74-6
:1-(2-Chloro-3-pyridinyl)cyclopropanamine
Description:
1-(2-Chloro-3-pyridinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety substituted with a chlorine atom. This compound typically exhibits properties associated with both amines and heterocyclic compounds. It is likely to be a solid at room temperature, with potential for moderate solubility in polar solvents due to the presence of the amine functional group. The chlorine substituent can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the pyridine ring may contribute to its biological activity, as many pyridine derivatives are known for their pharmacological properties. The compound's molecular interactions could be significant in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-7-6(2-1-5-11-7)8(10)3-4-8/h1-2,5H,3-4,10H2
InChI key:InChIKey=GVOVNQWRTCQLAT-UHFFFAOYSA-N
SMILES:NC1(C2=C(Cl)N=CC=C2)CC1
Synonyms:- 1-(2-Chloro-3-pyridinyl)cyclopropanamine
- Cyclopropanamine, 1-(2-chloro-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.