CymitQuimica logo

CAS 1060811-84-8

:

1-(6-Chloro-3-pyridinyl)cyclopropanemethanamine

Description:
1-(6-Chloro-3-pyridinyl)cyclopropanemethanamine, identified by its CAS number 1060811-84-8, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety. The presence of the chloro substituent on the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an amine due to the presence of the amine functional group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. Its structural configuration suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and interaction with biological systems would depend on its specific functional groups and overall molecular structure. As with many organic compounds, safety and handling precautions are essential, given the potential for toxicity associated with halogenated compounds. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C9H11ClN2
InChI:InChI=1S/C9H11ClN2/c10-8-2-1-7(5-12-8)9(6-11)3-4-9/h1-2,5H,3-4,6,11H2
InChI key:InChIKey=YZNUBCNBWKBCQQ-UHFFFAOYSA-N
SMILES:C(N)C1(CC1)C=2C=CC(Cl)=NC2
Synonyms:
  • [1-(6-Chloropyridin-3-yl)cyclopropyl]methanamine
  • Cyclopropanemethanamine, 1-(6-chloro-3-pyridinyl)-
  • 1-(6-Chloro-3-pyridinyl)cyclopropanemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.