CymitQuimica logo

CAS 1060811-92-8

:

2-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine

Description:
2-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chloro group and a trifluoromethyl group. This compound features a primary amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The chloro substituent may also affect the compound's reactivity and stability. Typically, compounds like this are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Safety data and handling precautions should be considered due to the potential hazards associated with halogenated compounds and amines.
Formula:C7H6ClF3N2
InChI:InChI=1S/C7H6ClF3N2/c8-6-4(2-1-3-13-6)5(12)7(9,10)11/h1-3,5H,12H2
InChI key:InChIKey=DFXFHPRSPFOMIT-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=C(Cl)N=CC=C1
Synonyms:
  • 2-Chloro-α-(trifluoromethyl)-3-pyridinemethanamine
  • 3-Pyridinemethanamine, 2-chloro-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.