CymitQuimica logo

CAS 1060811-93-9

:

6-Chloro-α-(trifluoromethyl)-2-pyridinemethanamine

Description:
6-Chloro-α-(trifluoromethyl)-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 6-position and a trifluoromethyl group at the α-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and exhibits polar characteristics due to the electronegative chlorine and fluorine atoms, which can influence its solubility in various solvents. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry and drug design. Additionally, the amine functional group can participate in hydrogen bonding, affecting its interaction with biological targets. Overall, 6-Chloro-α-(trifluoromethyl)-2-pyridinemethanamine is a compound of interest for its potential applications in pharmaceuticals and agrochemicals, particularly in the development of new therapeutic agents.
Formula:C7H6ClF3N2
InChI:InChI=1S/C7H6ClF3N2/c8-5-3-1-2-4(13-5)6(12)7(9,10)11/h1-3,6H,12H2
InChI key:InChIKey=QQHCZQMEAYQWKJ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C=1N=C(Cl)C=CC1
Synonyms:
  • 6-Chloro-α-(trifluoromethyl)-2-pyridinemethanamine
  • 2-Pyridinemethanamine, 6-chloro-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.