CAS 1060812-09-0

2-Chloro-α,α-dimethyl-3-pyridinemethanamine

Description:

2-Chloro-α,α-dimethyl-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the chloro group and the dimethyl substituents on the α-carbon contributes to its unique reactivity and potential biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form salts with acids. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine moiety, which is often found in biologically active compounds. The compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the pyridine ring. Additionally, safety and handling precautions should be observed, as with many nitrogen-containing compounds, due to potential toxicity or reactivity. Overall, 2-Chloro-α,α-dimethyl-3-pyridinemethanamine represents a class of compounds that may have significant implications in chemical research and development.

Formula: C₈H₁₁ClN₂

InChI: InChI=1S/C8H11ClN2/c1-8(2,10)6-4-3-5-11-7(6)9/h3-5H,10H2,1-2H3

InChI key: InChIKey=XQYIJSZLSMTHFY-UHFFFAOYSA-N

SMILES: C(C)(C)(N)C1=C(Cl)N=CC=C1

Synonyms:

• 2-Chloro-α,α-dimethyl-3-pyridinemethanamine
• 3-Pyridinemethanamine, 2-chloro-α,α-dimethyl-