CAS 1060812-16-9

6-[(Methylamino)methyl]-2-pyridinecarbonitrile

Description:

6-[(Methylamino)methyl]-2-pyridinecarbonitrile, identified by its CAS number 1060812-16-9, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methylamino group attached to a methylene bridge, linking it to the pyridine carbon, and a cyano group (-C≡N) at the 2-position of the pyridine ring. The presence of the cyano group contributes to its potential reactivity and polarity, making it useful in various chemical applications, including medicinal chemistry and organic synthesis. The compound's structure suggests it may exhibit basic properties due to the nitrogen atom in the pyridine ring and the methylamino group, which can participate in hydrogen bonding. Additionally, the presence of the cyano group may enhance its ability to act as a nucleophile or electrophile in chemical reactions. Overall, this compound's unique functional groups and structural features make it a subject of interest in research and development within the field of organic chemistry.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c1-10-6-8-4-2-3-7(5-9)11-8/h2-4,10H,6H2,1H3

InChI key: InChIKey=PCRNPBZJTDBOKY-UHFFFAOYSA-N

SMILES: C(NC)C=1N=C(C#N)C=CC1

Synonyms:

• 2-Pyridinecarbonitrile, 6-[(methylamino)methyl]-
• 6-[(Methylamino)methyl]-2-pyridinecarbonitrile