
CAS 1060812-25-0
:5-(2,2,2-Trifluoroacetyl)-2-pyridinecarbonitrile
Description:
5-(2,2,2-Trifluoroacetyl)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the trifluoroacetyl group introduces significant electronegativity and polarity, influencing the compound's reactivity and solubility. The cyano group (-C≡N) attached to the pyridine ring contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is likely to exhibit properties such as high thermal stability and potential biological activity due to the presence of both the cyano and trifluoroacetyl functionalities. Its unique structure may also impart specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the trifluoromethyl group can enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, 5-(2,2,2-Trifluoroacetyl)-2-pyridinecarbonitrile is a compound of interest for further research and application in various chemical fields.
Formula:C8H3F3N2O
InChI:InChI=1S/C8H3F3N2O/c9-8(10,11)7(14)5-1-2-6(3-12)13-4-5/h1-2,4H
InChI key:InChIKey=JUHUWPPGNARXHJ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1C=CC(C#N)=NC1
Synonyms:- 2-Pyridinecarbonitrile, 5-(2,2,2-trifluoroacetyl)-
- 5-(2,2,2-Trifluoroacetyl)-2-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.