CAS 1060812-29-4

5-(2-Aminoethyl)-2-pyridinecarbonitrile

Description:

5-(2-Aminoethyl)-2-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the cyano group (-C≡N) attached to the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The aminoethyl side chain introduces basic properties and can participate in hydrogen bonding, making the compound potentially useful in medicinal chemistry and as a building block for more complex molecules. This compound may exhibit polar characteristics due to the amino and cyano functional groups, influencing its solubility in polar solvents. Additionally, the structural features suggest that it could engage in various interactions, such as coordination with metal ions or participation in nucleophilic substitution reactions. Overall, 5-(2-Aminoethyl)-2-pyridinecarbonitrile is a versatile compound with potential applications in pharmaceuticals and organic synthesis, although specific properties such as melting point, boiling point, and spectral data would require further investigation for detailed characterization.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c9-4-3-7-1-2-8(5-10)11-6-7/h1-2,6H,3-4,9H2

InChI key: InChIKey=KJCJIYNETMHGMZ-UHFFFAOYSA-N

SMILES: C(CN)C=1C=CC(C#N)=NC1

Synonyms:

• 5-(2-Aminoethyl)-2-pyridinecarbonitrile
• 2-Pyridinecarbonitrile, 5-(2-aminoethyl)-