CAS 1060812-31-8

6-(2-Aminoethyl)-2-pyridinecarbonitrile

Description:

6-(2-Aminoethyl)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an aminoethyl side chain, which contributes to its potential as a building block in medicinal chemistry and organic synthesis. The presence of the cyano group (–C≡N) at the 2-position of the pyridine ring enhances its reactivity and may facilitate various chemical transformations. The amino group can participate in hydrogen bonding and may influence the compound's solubility and interaction with biological targets. This substance is typically studied for its potential applications in pharmaceuticals, particularly in the development of compounds with biological activity. Its molecular structure suggests that it may exhibit properties such as moderate polarity and the ability to form complexes with metal ions or other organic molecules. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, making it a subject of interest in both theoretical and applied chemistry.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c9-5-4-7-2-1-3-8(6-10)11-7/h1-3H,4-5,9H2

InChI key: InChIKey=VMOFPKDPPWWDOZ-UHFFFAOYSA-N

SMILES: C(CN)C=1N=C(C#N)C=CC1

Synonyms:

• 2-Pyridinecarbonitrile, 6-(2-aminoethyl)-
• 6-(2-Aminoethyl)-2-pyridinecarbonitrile