CAS 1060812-75-0

2-(Chloromethyl)-6-(trifluoromethyl)pyrazine

Description:

2-(Chloromethyl)-6-(trifluoromethyl)pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. This compound features a chloromethyl group (-CH2Cl) and a trifluoromethyl group (-CF3) attached to the pyrazine ring, contributing to its unique chemical properties. The chloromethyl group can participate in nucleophilic substitution reactions, while the trifluoromethyl group is known for its electron-withdrawing effects, influencing the compound's reactivity and stability. This substance is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as solubility and boiling point, can vary based on the presence of these functional groups. Additionally, the presence of fluorine atoms often enhances the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₆H₄ClF₃N₂

InChI: InChI=1S/C6H4ClF3N2/c7-1-4-2-11-3-5(12-4)6(8,9)10/h2-3H,1H2

InChI key: InChIKey=WAKVRKDWMHMRAE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=NC(CCl)=CN=C1

Synonyms:

• Pyrazine, 2-(chloromethyl)-6-(trifluoromethyl)-
• 2-(Chloromethyl)-6-(trifluoromethyl)pyrazine