CAS 1060812-78-3

6-(Trifluoromethyl)-2-pyrazinemethanol

Description:

6-(Trifluoromethyl)-2-pyrazinemethanol is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The hydroxymethyl group (-CH2OH) at the 2-position contributes to its reactivity, allowing for various chemical transformations, such as oxidation or substitution reactions. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding. Its trifluoromethyl group may also impart unique electronic properties, making it of interest in medicinal chemistry and material science. The compound's stability, solubility, and reactivity can be influenced by the presence of these functional groups, making it a candidate for further research in pharmaceuticals or agrochemicals. As with many fluorinated compounds, it may exhibit distinct environmental and toxicological profiles that warrant careful consideration in its application and handling.

Formula: C₆H₅F₃N₂O

InChI: InChI=1S/C6H5F3N2O/c7-6(8,9)5-2-10-1-4(3-12)11-5/h1-2,12H,3H2

InChI key: InChIKey=GRRJLLXPINEHRI-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=NC(CO)=CN=C1

Synonyms:

• 2-Pyrazinemethanol, 6-(trifluoromethyl)-
• 6-(Trifluoromethyl)-2-pyrazinemethanol