CAS 1060812-96-5

3-Bromo-2-ethoxy-4-methylpyridine

Description:

3-Bromo-2-ethoxy-4-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom, an ethoxy group, and a methyl group. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The ethoxy group contributes to the compound's solubility in organic solvents and can influence its polarity and reactivity. The methyl group, located at the 4-position of the pyridine ring, can affect the electronic properties of the molecule, potentially enhancing its nucleophilicity or electrophilicity depending on the reaction conditions. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Additionally, its properties can be influenced by factors such as temperature, solvent, and the presence of other functional groups, making it a versatile building block in chemical synthesis. Safety data should be consulted before handling, as brominated compounds can pose health risks.

Formula: C₈H₁₀BrNO

InChI: InChI=1S/C8H10BrNO/c1-3-11-8-7(9)6(2)4-5-10-8/h4-5H,3H2,1-2H3

InChI key: InChIKey=CEEQVMXHSSBLEG-UHFFFAOYSA-N

SMILES: O(CC)C1=C(Br)C(C)=CC=N1

Synonyms:

• Pyridine, 3-bromo-2-ethoxy-4-methyl-
• 3-Bromo-2-ethoxy-4-methylpyridine