CAS 1060813-09-3

1,1-Dimethylethyl N-(4-fluoro-2-iodophenyl)carbamate

Description:

1,1-Dimethylethyl N-(4-fluoro-2-iodophenyl)carbamate is a chemical compound characterized by its unique structure, which includes a carbamate functional group and a substituted aromatic ring. The presence of the 1,1-dimethylethyl group contributes to its steric hindrance, potentially influencing its reactivity and interactions with biological targets. The compound features a fluorine and iodine atom on the aromatic ring, which can affect its electronic properties and lipophilicity, making it of interest in medicinal chemistry and agrochemical applications. The fluorine atom may enhance metabolic stability, while the iodine atom can provide opportunities for radiolabeling in imaging studies. This compound is likely to exhibit specific solubility characteristics, depending on the solvent system, and may participate in various chemical reactions typical of carbamates, such as hydrolysis or nucleophilic substitution. Overall, its unique functional groups and structural features suggest potential utility in research and development within pharmaceutical and agricultural chemistry.

Formula: C₁₁H₁₃FINO₂

InChI: InChI=1S/C11H13FINO2/c1-11(2,3)16-10(15)14-9-5-4-7(12)6-8(9)13/h4-6H,1-3H3,(H,14,15)

InChI key: InChIKey=RVFPJEXQORZVIR-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C(I)C=C(F)C=C1

Synonyms:

• 1,1-Dimethylethyl N-(4-fluoro-2-iodophenyl)carbamate
• Carbamic acid, N-(4-fluoro-2-iodophenyl)-, 1,1-dimethylethyl ester

N-Boc 2-Iodo-4-fluoroaniline

CAS: 1060813-09-3

Formula: C₁₁H₁₃FINO₂

Molecular weight: 337.1293

Ref: IN-DA007VWQ