CAS 1060813-50-4

4-[(1,1-Dimethylethoxy)carbonyl]-3-methyl-1-piperazineacetic acid

Description:

4-[(1,1-Dimethylethoxy)carbonyl]-3-methyl-1-piperazineacetic acid is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a carboxylic acid functional group, contributing to its acidic properties, and an ester group derived from the 1,1-dimethylethoxy moiety, which enhances its lipophilicity and potential for biological activity. The presence of a methyl group at the 3-position of the piperazine ring adds to its steric bulk, potentially influencing its interaction with biological targets. The compound's structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 1060813-50-4, allows for precise identification in chemical databases. Overall, this compound's unique structural features may contribute to its reactivity and potential applications in drug development or other chemical processes.

Formula: C₁₂H₂₂N₂O₄

InChI: InChI=1S/C12H22N2O4/c1-9-7-13(8-10(15)16)5-6-14(9)11(17)18-12(2,3)4/h9H,5-8H2,1-4H3,(H,15,16)

InChI key: InChIKey=BASWBFJSUVXIOZ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(C)CN(CC(O)=O)CC1

Synonyms:

• 4-[(1,1-Dimethylethoxy)carbonyl]-3-methyl-1-piperazineacetic acid
• 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-3-methyl-