CAS 1060813-52-6

3-(1-Methylethyl)-1-piperazineacetic acid

Description:

3-(1-Methylethyl)-1-piperazineacetic acid, identified by its CAS number 1060813-52-6, is a chemical compound that features a piperazine ring, which is a six-membered cyclic amine structure. This compound is characterized by the presence of an isopropyl group (1-methylethyl) attached to the piperazine nitrogen, along with an acetic acid moiety. The piperazine structure contributes to its potential biological activity, as piperazines are often found in pharmaceuticals and can interact with various biological targets. The presence of the acetic acid functional group suggests that this compound may exhibit acidic properties, which can influence its solubility and reactivity in different environments. Additionally, the compound's structure may allow for hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetics and pharmacodynamics. Overall, 3-(1-Methylethyl)-1-piperazineacetic acid is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₉H₁₈N₂O₂

InChI: InChI=1S/C9H18N2O2/c1-7(2)8-5-11(4-3-10-8)6-9(12)13/h7-8,10H,3-6H2,1-2H3,(H,12,13)

InChI key: InChIKey=DQLRUFFZUGGVFH-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC(C(C)C)NCC1

Synonyms:

• 1-Piperazineacetic acid, 3-(1-methylethyl)-
• 3-(1-Methylethyl)-1-piperazineacetic acid