CymitQuimica logo

CAS 1060813-92-4

:

2-Methyl-1-piperazinepropanoic acid

Description:
2-Methyl-1-piperazinepropanoic acid is an organic compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a propanoic acid moiety, contributing to its acidic properties. The presence of the methyl group at the second position of the piperazine ring influences its steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. Typically, compounds like this may exhibit solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The piperazine ring can also participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Its specific applications may vary, but it could be explored for potential therapeutic uses, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C8H16N2O2
InChI:InChI=1S/C8H16N2O2/c1-7-6-9-3-5-10(7)4-2-8(11)12/h7,9H,2-6H2,1H3,(H,11,12)
InChI key:InChIKey=ZZVUKMSAGQZUBQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C(C)CNCC1
Synonyms:
  • 1-Piperazinepropanoic acid, 2-methyl-
  • 2-Methyl-1-piperazinepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.