
CAS 1060813-93-5
:4-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-1-piperazinepropanoic acid
Description:
4-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-1-piperazinepropanoic acid is a chemical compound characterized by its complex structure, which includes a piperazine ring, a propanoic acid moiety, and a dimethylethoxycarbonyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it potentially useful in various chemical applications, including pharmaceuticals and organic synthesis. The presence of the piperazine ring contributes to its basicity and potential for forming salts, while the carboxylic acid group provides acidic characteristics. The dimethylethoxycarbonyl group enhances the compound's stability and solubility in organic solvents. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as pH and temperature.
Formula:C13H24N2O4
InChI:InChI=1S/C13H24N2O4/c1-10-9-15(12(18)19-13(2,3)4)8-7-14(10)6-5-11(16)17/h10H,5-9H2,1-4H3,(H,16,17)
InChI key:InChIKey=WTDJNKSAVVRASP-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(C)N(CCC(O)=O)CC1
Synonyms:- 1-Piperazinepropanoic acid, 4-[(1,1-dimethylethoxy)carbonyl]-2-methyl-
- 4-[(1,1-Dimethylethoxy)carbonyl]-2-methyl-1-piperazinepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.