CymitQuimica logo

CAS 1060814-32-5

:

4-(3-Isoxazolyl)piperidine

Description:
4-(3-Isoxazolyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the isoxazole moiety, a five-membered ring containing both nitrogen and oxygen, contributes to its unique properties and potential biological activity. This compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in the context of neuropharmacology and as a scaffold for designing new therapeutic agents. Its molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in the development of pharmaceuticals. Additionally, the compound's solubility, stability, and reactivity can vary based on its functional groups and the overall molecular architecture. As with many heterocyclic compounds, the synthesis and characterization of 4-(3-Isoxazolyl)piperidine are crucial for understanding its potential applications and mechanisms of action in biological systems.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-4-9-5-2-7(1)8-3-6-11-10-8/h3,6-7,9H,1-2,4-5H2
InChI key:InChIKey=KGDGSULSAJSJRK-UHFFFAOYSA-N
SMILES:C=1(C=CON1)C2CCNCC2
Synonyms:
  • Piperidine, 4-(3-isoxazolyl)-
  • 3-(Piperidin-4-yl)isoxazole
  • 4-(3-Isoxazolyl)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.