CAS 1060814-52-9
:6-Chloro-2-pyrazinemethanamine
Description:
6-Chloro-2-pyrazinemethanamine is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 6-position of the pyrazine ring contributes to its reactivity and potential applications in various chemical reactions. The methanamine group attached to the 2-position enhances its basicity and nucleophilicity, making it a useful intermediate in organic synthesis. This compound may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its solubility and stability in different solvents can vary, influencing its practical applications. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 6-Chloro-2-pyrazinemethanamine represents a versatile building block in synthetic chemistry, with implications in both industrial and research settings.
Formula:C5H6ClN3
InChI:InChI=1S/C5H6ClN3/c6-5-3-8-2-4(1-7)9-5/h2-3H,1,7H2
InChI key:InChIKey=ODFNSYFUAVUKRF-UHFFFAOYSA-N
SMILES:C(N)C1=NC(Cl)=CN=C1
Synonyms:- 6-Chloro-2-pyrazinemethanamine
- 2-Pyrazinemethanamine, 6-chloro-
- (6-Chloropyrazin-2-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
