
CAS 1060814-62-1
:α-(Aminomethyl)-4-(trifluoromethyl)benzeneacetic acid
Description:
α-(Aminomethyl)-4-(trifluoromethyl)benzeneacetic acid, identified by its CAS number 1060814-62-1, is an organic compound characterized by the presence of both an amino group and a trifluoromethyl group attached to a benzene ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The trifluoromethyl group is known for imparting unique electronic and steric effects, enhancing the compound's lipophilicity and potentially influencing its biological activity. The amino group allows for hydrogen bonding, which can affect solubility and reactivity. This compound may be of interest in pharmaceutical research due to its potential applications in drug development, particularly in the design of compounds with specific biological activities. Its structural features suggest that it could interact with various biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, the combination of functional groups in this molecule suggests a versatile compound with potential utility in various chemical and biological contexts.
Formula:C10H10F3NO2
InChI:InChI=1S/C10H10F3NO2/c11-10(12,13)7-3-1-6(2-4-7)8(5-14)9(15)16/h1-4,8H,5,14H2,(H,15,16)
InChI key:InChIKey=XYYPXHLJMILYKK-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CN)C1=CC=C(C(F)(F)F)C=C1
Synonyms:- α-(Aminomethyl)-4-(trifluoromethyl)benzeneacetic acid
- 3-Amino-2-[4-(trifluoromethyl)phenyl]propanoic acid
- Benzeneacetic acid, α-(aminomethyl)-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.