CAS 1060814-71-2

α-(Aminomethyl)-2-pyridineacetic acid

Description:

α-(Aminomethyl)-2-pyridineacetic acid, also known by its CAS number 1060814-71-2, is an organic compound characterized by its pyridine and amino acid structure. This compound features a pyridine ring, which contributes to its aromatic properties, and an amino group that enhances its reactivity and potential for forming hydrogen bonds. The presence of the carboxylic acid functional group allows it to exhibit acidic behavior, making it soluble in polar solvents. Its structural configuration suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or metabolic pathways, due to the pyridine moiety's role in biological systems. Additionally, the compound may exhibit chiral properties, which can influence its biological activity and interactions. Overall, α-(Aminomethyl)-2-pyridineacetic acid is a versatile compound with significant implications in medicinal chemistry and biochemistry, warranting further investigation into its properties and potential applications.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1S/C8H10N2O2/c9-5-6(8(11)12)7-3-1-2-4-10-7/h1-4,6H,5,9H2,(H,11,12)

InChI key: InChIKey=SNGJRSJGEMPKOB-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CN)C1=CC=CC=N1

Synonyms:

• α-(Aminomethyl)-2-pyridineacetic acid
• 2-Pyridineacetic acid, α-(aminomethyl)-