
CAS 1060814-98-3
:1-[5-(Trifluoromethoxy)-2-pyridinyl]ethanone
Description:
1-[5-(Trifluoromethoxy)-2-pyridinyl]ethanone, identified by its CAS number 1060814-98-3, is an organic compound characterized by its pyridine ring substituted with a trifluoromethoxy group and an ethanone moiety. This compound typically exhibits a polar nature due to the presence of electronegative fluorine atoms, which can influence its solubility and reactivity. The trifluoromethoxy group is known for imparting unique electronic properties, enhancing the compound's potential as a pharmaceutical intermediate or agrochemical. The presence of the pyridine ring contributes to its aromatic stability and may affect its interaction with biological targets. Additionally, the ethanone functional group suggests potential reactivity in nucleophilic addition or condensation reactions. Overall, this compound's distinctive structural features make it of interest in various fields, including medicinal chemistry and materials science, where its properties can be exploited for specific applications.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c1-5(13)7-3-2-6(4-12-7)14-8(9,10)11/h2-4H,1H3
InChI key:InChIKey=JHYMSKNLNOPKCU-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=CC(C(C)=O)=NC1
Synonyms:- Ethanone, 1-[5-(trifluoromethoxy)-2-pyridinyl]-
- 1-[5-(Trifluoromethoxy)-2-pyridinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.