
CAS 1060815-13-5
:1-(4,6-Dichloro-2-pyridinyl)-2,2,2-trifluoroethanone
Description:
1-(4,6-Dichloro-2-pyridinyl)-2,2,2-trifluoroethanone, identified by its CAS number 1060815-13-5, is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with dichloro groups and a trifluoroethanone moiety. This compound typically exhibits properties associated with halogenated organic compounds, such as increased stability and potential reactivity due to the presence of electronegative chlorine and fluorine atoms. The dichloro substitution on the pyridine ring can influence its electronic properties, potentially enhancing its biological activity or reactivity in various chemical processes. Additionally, the trifluoroethanone group contributes to its polar character, which may affect its solubility in different solvents. This compound may be of interest in fields such as medicinal chemistry, agrochemicals, or materials science, where its specific functional groups can be leveraged for desired chemical reactivity or biological activity. Safety and handling precautions should be observed due to the presence of halogens, which can pose environmental and health risks.
Formula:C7H2Cl2F3NO
InChI:InChI=1S/C7H2Cl2F3NO/c8-3-1-4(13-5(9)2-3)6(14)7(10,11)12/h1-2H
InChI key:InChIKey=UMELUHIMLZAKBF-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC(Cl)=CC(Cl)=N1
Synonyms:- Ethanone, 1-(4,6-dichloro-2-pyridinyl)-2,2,2-trifluoro-
- 1-(4,6-Dichloro-2-pyridinyl)-2,2,2-trifluoroethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.