CAS 1060815-63-5

2-Bromo-6-chloro-4-pyridinemethanamine

Description:

2-Bromo-6-chloro-4-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of bromine and chlorine substituents at the 2 and 6 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. The amine functional group at the 4-position enhances its nucleophilicity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound may exhibit polar characteristics due to the electronegative halogen atoms and the amine group, influencing its solubility and interaction with biological systems. Additionally, the presence of multiple functional groups suggests potential for diverse chemical transformations, including substitution and coupling reactions. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks. Overall, 2-Bromo-6-chloro-4-pyridinemethanamine is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₆H₆BrClN₂

InChI: InChI=1S/C6H6BrClN2/c7-5-1-4(3-9)2-6(8)10-5/h1-2H,3,9H2

InChI key: InChIKey=NQRYLRHCIKSURF-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(Br)N=C(Cl)C1

Synonyms:

• (2-Bromo-6-chloro-4-pyridyl)methanamine
• 4-Pyridinemethanamine, 2-bromo-6-chloro-
• 2-Bromo-6-chloro-4-pyridinemethanamine
• (2-Bromo-6-chloropyridin-4-yl)methanamine