CAS 1060815-67-9

6-Bromo-2-chloro-3-pyridinecarboxylic acid

Description:

6-Bromo-2-chloro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and chlorine atoms, as well as a carboxylic acid functional group. The bromine atom is located at the 6-position, while the chlorine is at the 2-position of the pyridine ring, contributing to its unique reactivity and potential applications in various chemical syntheses. The carboxylic acid group enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogen substituents can influence the compound's electronic properties, potentially affecting its reactivity and stability. Overall, 6-Bromo-2-chloro-3-pyridinecarboxylic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₆H₃BrClNO₂

InChI: InChI=1S/C6H3BrClNO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11)

InChI key: InChIKey=CSHIGVLXOXJJMY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)N=C(Br)C=C1

Synonyms:

• 6-Bromo-2-chloronicotinic acid
• 6-Bromo-2-chloro-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-bromo-2-chloro-

6-Bromo-2-chloronicotinic acid

CAS: 1060815-67-9

Formula: C₆H₃BrClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.4505

Ref: IN-DA003N3R

6-Bromo-2-chloronicotinic acid

CAS: 1060815-67-9

6-Bromo-2-chloronicotinic acid

Purity: 97%

Molecular weight: 236.45g/mol

Ref: 54-OR84372

6-Bromo-2-chloronicotinic acid

CAS: 1060815-67-9

Formula: C₆H₃BrClNO₂

Purity: 97%

Molecular weight: 236.45

Ref: 10-F220434

6-Bromo-2-chloronicotinic Acid

Controlled Product

CAS: 1060815-67-9

Applications 6-Bromo-2-chloronicotinic acid

Formula: C₆H₃BrClNO₂

Color and Shape: Neat

Molecular weight: 236.451

Ref: TR-B684118

6-Bromo-2-chloronicotinic acid

CAS: 1060815-67-9

Versatile small molecule scaffold

Formula: C₆H₃BrClNO₂

Purity: Min. 95%

Molecular weight: 236.45 g/mol

Ref: 3D-KSB81567