CAS 1060815-96-4

Ethanone, 1-[4-(trifluoromethyl)-2-thiazolyl]-

Description:

Ethanone, 1-[4-(trifluoromethyl)-2-thiazolyl]- is a chemical compound characterized by its unique structural features, including a thiazole ring and a trifluoromethyl group. The thiazole moiety contributes to its potential biological activity, often associated with various pharmacological properties. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the compound, which can influence its reactivity and interactions with biological targets. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential applications in drug design and synthesis. Its molecular structure suggests that it may exhibit interesting electronic properties, making it a candidate for further studies in organic synthesis and material science. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns. Overall, the compound's characteristics make it a subject of interest in various scientific investigations.

Formula: C₆H₄F₃NOS

InChI: InChI=1S/C6H4F3NOS/c1-3(11)5-10-4(2-12-5)6(7,8)9/h2H,1H3

InChI key: InChIKey=VGGMVWKKEMAJJF-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(C(C)=O)SC1

Synonyms:

• 1-[4-(Trifluoromethyl)-1,3-thiazol-2-yl]ethan-1-one
• 1-(4-(Trifluoromethyl)thiazol-2-yl)ethanone
• Ethanone, 1-[4-(trifluoromethyl)-2-thiazolyl]-
• 1-[4-(Trifluoromethyl)-1,3-thiazol-2-yl]ethanone

1-[4-(Trifluoromethyl)-1,3-thiazol-2-yl]ethan-1-one

CAS: 1060815-96-4

Versatile small molecule scaffold

Formula: C₆H₄F₃NOS

Purity: Min. 95%

Molecular weight: 195.16 g/mol

Ref: 3D-KSB81596