CAS 1060816-08-1: 2-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid
Description:2-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. The oxazole moiety can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which may be relevant for synthetic applications. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. Overall, 2-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid represents a unique structure with potential applications in various fields, including medicinal chemistry and material science.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c1-8(2,3)7-9-5(4-12-7)6(10)11/h4H,1-3H3,(H,10,11)
InChI key:InChIKey=GVWUJKRGBRORLJ-UHFFFAOYSA-N
SMILES:O=C(O)C=1N=C(OC1)C(C)(C)C
- Synonyms:
- 4-Oxazolecarboxylic acid, 2-(1,1-dimethylethyl)-
- 2-(1,1-Dimethylethyl)-4-oxazolecarboxylic acid
- 2-tert-Butyl-1,3-oxazole-4-carboxylic acid
- 2-(tert-Butyl)oxazole-4-carboxylic acid
- 2-tert-Butyl-oxazole-4-carboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(tert-Butyl)oxazole-4-carboxylic acid REF: IN-DA0092T0CAS: 1060816-08-1 | - - - | To inquire | Mon 24 Mar 25 |
![]() | 2-tert-Butyl-oxazole-4-carboxylic acid REF: 10-F736862CAS: 1060816-08-1 | 96% | To inquire | Thu 03 Apr 25 |
![]() | 2-tert-Butyl-oxazole-4-carboxylic acid REF: 3D-KSB81608CAS: 1060816-08-1 | Min. 95% | - - - | Discontinued product |

Ref: 10-F736862
1g | To inquire | ||
250mg | To inquire |

2-tert-Butyl-oxazole-4-carboxylic acid
Ref: 3D-KSB81608
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |