CAS 1060816-16-1

2-Chloro-4-(1-methylethyl)oxazole

Description:

2-Chloro-4-(1-methylethyl)oxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chlorine atom at the 2-position and an isopropyl group at the 4-position contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The chlorine substituent can enhance electrophilic reactivity, making it useful in various chemical reactions. Additionally, the isopropyl group can influence the compound's solubility and stability. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Proper storage and disposal methods are essential to mitigate risks associated with its use.

Formula: C₆H₈ClNO

InChI: InChI=1S/C6H8ClNO/c1-4(2)5-3-9-6(7)8-5/h3-4H,1-2H3

InChI key: InChIKey=BWGOWFAWFJOIPN-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N=C(Cl)OC1

Synonyms:

• 2-Chloro-4-(1-methylethyl)oxazole
• Oxazole, 2-chloro-4-(1-methylethyl)-