CAS 1060816-24-1

2-Chloro-5-(1-methylethyl)oxazole

Description:

2-Chloro-5-(1-methylethyl)oxazole is a heterocyclic organic compound characterized by the presence of both a chloro substituent and an isopropyl group attached to an oxazole ring. The oxazole moiety consists of a five-membered ring containing both nitrogen and oxygen atoms, which contributes to its reactivity and potential applications in various chemical reactions. The chlorine atom introduces electrophilic characteristics, making the compound useful in synthetic organic chemistry. The isopropyl group enhances the hydrophobic nature of the molecule, potentially influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for various functionalization possibilities, which can lead to the development of derivatives with tailored properties. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use. Overall, 2-Chloro-5-(1-methylethyl)oxazole represents a versatile compound in the field of organic synthesis and medicinal chemistry.

Formula: C₆H₈ClNO

InChI: InChI=1S/C6H8ClNO/c1-4(2)5-3-8-6(7)9-5/h3-4H,1-2H3

InChI key: InChIKey=LUSKSKISXBFLRV-UHFFFAOYSA-N

SMILES: C(C)(C)C=1OC(Cl)=NC1

Synonyms:

• 2-Chloro-5-(1-methylethyl)oxazole
• Oxazole, 2-chloro-5-(1-methylethyl)-

2-Chloro-5-(propan-2-yl)-1,3-oxazole

CAS: 1060816-24-1

Versatile small molecule scaffold

Formula: C₆H₈ClNO

Purity: Min. 95%

Molecular weight: 145.59 g/mol

Ref: 3D-KSB81624