
CAS 1060816-25-2
:2-Chloro-5-(1,1-dimethylethyl)oxazole
Description:
2-Chloro-5-(1,1-dimethylethyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chlorine atom at the 2-position and a tert-butyl group at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The chlorine substituent can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the bulky tert-butyl group can influence the compound's steric properties, affecting its interactions with biological targets. As with many halogenated compounds, it is important to handle 2-Chloro-5-(1,1-dimethylethyl)oxazole with care due to potential toxicity and environmental concerns.
Formula:C7H10ClNO
InChI:InChI=1S/C7H10ClNO/c1-7(2,3)5-4-9-6(8)10-5/h4H,1-3H3
InChI key:InChIKey=BPAHMQKXCJCJRN-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1OC(Cl)=NC1
Synonyms:- Oxazole, 2-chloro-5-(1,1-dimethylethyl)-
- 2-Chloro-5-(1,1-dimethylethyl)oxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.