
CAS 1060816-48-9
:1,2,3,4-Tetrahydro-5-methoxy-2,6-naphthyridine
Description:
1,2,3,4-Tetrahydro-5-methoxy-2,6-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, and a methoxy group (-OCH3) that contributes to its chemical properties and reactivity. The presence of the methoxy group can influence the compound's polarity, solubility, and potential interactions with biological targets. As a naphthyridine derivative, it may exhibit interesting pharmacological activities, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require further investigation. Its CAS number, 1060816-48-9, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound represents a unique scaffold for further exploration in both synthetic and medicinal chemistry.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-12-9-8-3-4-10-6-7(8)2-5-11-9/h2,5,10H,3-4,6H2,1H3
InChI key:InChIKey=PWOBLYJANXSUSF-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=N1)CNCC2
Synonyms:- 2,6-Naphthyridine, 1,2,3,4-tetrahydro-5-methoxy-
- 1,2,3,4-Tetrahydro-5-methoxy-2,6-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.