CAS 1060816-67-2

2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine

Description:

2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the second position and a methyl group at the seventh position of the pyrrolo-pyrimidine structure influences its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The compound may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of the chlorine atom. Additionally, its heterocyclic nature allows for interactions with biological targets, which can be explored for therapeutic purposes. As with many heterocycles, the stability and reactivity of 2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine can be influenced by environmental factors such as pH and temperature.

Formula: C₇H₆N₃Cl

InChI: InChI=1S/C7H6ClN3/c1-11-3-2-5-4-9-7(8)10-6(5)11/h2-4H,1H3

SMILES: Cn1ccc2cnc(Cl)nc12

Synonyms:

• 2-Chloro-7-Methyl-7H-pyrr...

2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 1060816-67-2

Formula: C₇H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA0093XV

2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 1060816-67-2

2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine

Formula: C₇H₆ClN₃

Purity: By hplc: 99.5% (Typical Value in Batch COA)

Color and Shape: light yellow solid

Molecular weight: 167.60g/mol

Ref: 54-OR317013

2-Chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 1060816-67-2

Formula: C₇H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 167.6

Ref: 10-F215163