CAS 1060817-44-8
:3-(4-Fluorophenyl)tetrahydro-3-furancarboxaldehyde
Description:
3-(4-Fluorophenyl)tetrahydro-3-furancarboxaldehyde is an organic compound characterized by its unique structure, which includes a tetrahydrofuran ring fused with a carbonyl group and a fluorophenyl substituent. This compound features a furan moiety, contributing to its potential reactivity and interactions in various chemical environments. The presence of the 4-fluorophenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The aldehyde functional group is reactive, allowing for further derivatization and potential applications in organic synthesis. Additionally, the compound's molecular structure suggests it may exhibit interesting physical properties, such as solubility in organic solvents and specific melting or boiling points, which are essential for its handling and application in laboratory settings. Overall, 3-(4-Fluorophenyl)tetrahydro-3-furancarboxaldehyde represents a versatile building block in organic synthesis and may have implications in pharmaceutical development due to its structural characteristics.
Formula:C11H11FO2
InChI:InChI=1S/C11H11FO2/c12-10-3-1-9(2-4-10)11(7-13)5-6-14-8-11/h1-4,7H,5-6,8H2
InChI key:InChIKey=FMKGNBPMWWCKQY-UHFFFAOYSA-N
SMILES:C(=O)C1(CCOC1)C2=CC=C(F)C=C2
Synonyms:- 3-Furancarboxaldehyde, 3-(4-fluorophenyl)tetrahydro-
- 3-(4-Fluorophenyl)tetrahydro-3-furancarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.