CAS 1060817-49-3
:5-Cyclopropyl-3-isoxazolemethanamine
Description:
5-Cyclopropyl-3-isoxazolemethanamine is a chemical compound characterized by its unique structural features, including a cyclopropyl group and an isoxazole ring. The isoxazole moiety contributes to its potential biological activity, as compounds containing this functional group are often explored for pharmacological properties. The presence of the methanamine group suggests that it may exhibit basic properties, which can influence its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions with biological targets would depend on its three-dimensional conformation and the electronic properties imparted by the cyclopropyl and isoxazole substituents. Additionally, the compound's stability, reactivity, and potential applications in drug discovery would be influenced by its functional groups and overall molecular structure. As with many synthetic organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c8-4-6-3-7(10-9-6)5-1-2-5/h3,5H,1-2,4,8H2
InChI key:InChIKey=YAGKRVQCDOMDOS-UHFFFAOYSA-N
SMILES:C(N)C=1C=C(ON1)C2CC2
Synonyms:- 3-Isoxazolemethanamine, 5-cyclopropyl-
- (5-Cyclopropylisoxazol-3-yl)methylamine
- (5-Cyclopropyl-1,2-oxazol-3-yl)methanamine
- 5-Cyclopropyl-3-isoxazolemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.