
CAS 1060817-65-3
:N-Ethyltetrahydro-2,2-dimethyl-2H-pyran-4-amine
Description:
N-Ethyltetrahydro-2,2-dimethyl-2H-pyran-4-amine is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring with ethyl and dimethyl substituents. This compound features a nitrogen atom in its amine functional group, contributing to its basicity and potential reactivity. The presence of the tetrahydropyran ring suggests that it may exhibit properties typical of cyclic amines, such as moderate polarity and the ability to participate in hydrogen bonding. Its molecular structure may influence its solubility in various solvents, likely making it more soluble in organic solvents than in water. Additionally, the compound may have applications in organic synthesis or medicinal chemistry, given the presence of both the amine and cyclic ether functionalities, which can be pivotal in drug design and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its physical and chemical properties, as well as its biological activity.
Formula:C9H19NO
InChI:InChI=1S/C9H19NO/c1-4-10-8-5-6-11-9(2,3)7-8/h8,10H,4-7H2,1-3H3
InChI key:InChIKey=CHHKBQOLWAUFPM-UHFFFAOYSA-N
SMILES:N(CC)C1CC(C)(C)OCC1
Synonyms:- N-Ethyltetrahydro-2,2-dimethyl-2H-pyran-4-amine
- 2H-Pyran-4-amine, N-ethyltetrahydro-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.