CAS 1060817-67-5

3,4-Dihydro-3-methyl-4-oxo-7-quinazolinecarboxylic acid

Description:

3,4-Dihydro-3-methyl-4-oxo-7-quinazolinecarboxylic acid is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methyl group and a keto group enhances its chemical properties, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various diseases. Additionally, the compound's stability, reactivity, and solubility can vary based on environmental conditions, such as pH and temperature. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 3,4-Dihydro-3-methyl-4-oxo-7-quinazolinecarboxylic acid represents a unique structure with potential applications in various fields of chemistry and biology.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c1-12-5-11-8-4-6(10(14)15)2-3-7(8)9(12)13/h2-5H,1H3,(H,14,15)

InChI key: InChIKey=VXTJQVWLKUDPMD-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(C(O)=O)=CC2)N=CN1C

Synonyms:

• 7-Quinazolinecarboxylic acid, 3,4-dihydro-3-methyl-4-oxo-
• 3-Methyl-4-oxoquinazoline-7-carboxylic acid
• 3-Methyl-4-oxo-3,4-dihydroquinazoline-7-carboxylic acid
• 3,4-Dihydro-3-methyl-4-oxo-7-quinazolinecarboxylic acid

3-Methyl-4-oxo-3,4-dihydro-7-quinazolinecarboxylic acid

CAS: 1060817-67-5

Formula: C₁₀H₈N₂O₃

Purity: 95%

Molecular weight: 204.1821

Ref: IN-DA009962

3-methyl-4-oxo-3,4-dihydro-7-quinazolinecarboxylic acid

CAS: 1060817-67-5

Purity: 95.0%

Molecular weight: 204.18499755859375

Ref: 10-F311697